C24H24F4N4O3 — CID 53029131
4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 53029131) has the molecular formula C24H24F4N4O3 and a molecular weight of 492.47 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 53029131 |
| Molecular Formula | C24H24F4N4O3 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CCC(N2CCN(Cc3ccc(F)cc3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C24H24F4N4O3/c25-17-7-5-16(6-8-17)15-31-13-14-32(22(34)21(31)33)18-9-11-30(12-10-18)23(35)29-20-4-2-1-3-19(20)24(26,27)28/h1-8,18H,9-15H2,(H,29,35) |
| InChIKey | JDLCNVOMJKEADD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|