C19H15F4N3O3 — CID 167998424
2-[4-(4-fluorophenyl)-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 167998424) has the molecular formula C19H15F4N3O3 and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 167998424 |
| Molecular Formula | C19H15F4N3O3 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,3-dioxopiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(F)cc2)C(=O)C1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H15F4N3O3/c20-12-5-7-13(8-6-12)26-10-9-25(17(28)18(26)29)11-16(27)24-15-4-2-1-3-14(15)19(21,22)23/h1-8H,9-11H2,(H,24,27) |
| InChIKey | GNEFQMGYWFFIOM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|