C21H29FN4O3 — CID 93060584
N-[(2S)-butan-2-yl]-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide (PubChem CID 93060584) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93060584 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
| SMILES | CC[C@H](C)NC(=O)N1CCC(N2CCN(Cc3ccc(F)cc3)C(=O)C2=O)CC1 |
| InChI | InChI=1S/C21H29FN4O3/c1-3-15(2)23-21(29)24-10-8-18(9-11-24)26-13-12-25(19(27)20(26)28)14-16-4-6-17(22)7-5-16/h4-7,15,18H,3,8-14H2,1-2H3,(H,23,29)/t15-/m0/s1 |
| InChIKey | FQMTXYCRVUZPBH-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|