C20H24N4O4S — CID 158586511
formic acid;6-(4-methyl-1,4-diazepan-1-yl)-1-pyridin-3-ylsulfonylindole (PubChem CID 158586511) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is formic acid;6-(4-methyl-1,4-diazepan-1-yl)-1-pyridin-3-ylsulfonylindole.
| Compound Name | formic acid;6-(4-methyl-1,4-diazepan-1-yl)-1-pyridin-3-ylsulfonylindole |
|---|---|
| PubChem CID | 158586511 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | formic acid;6-(4-methyl-1,4-diazepan-1-yl)-1-pyridin-3-ylsulfonylindole |
| SMILES | CN1CCCN(c2ccc3ccn(S(=O)(=O)c4cccnc4)c3c2)CC1.O=CO |
| InChI | InChI=1S/C19H22N4O2S.CH2O2/c1-21-9-3-10-22(13-12-21)17-6-5-16-7-11-23(19(16)14-17)26(24,25)18-4-2-8-20-15-18;2-1-3/h2,4-8,11,14-15H,3,9-10,12-13H2,1H3;1H,(H,2,3) |
| InChIKey | HTWVDZOTOXPQRL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|