C20H23N3O2 — CID 141386094
6-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-3-yl-2,3-dihydrochromen-4-one (PubChem CID 141386094) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-3-yl-2,3-dihydrochromen-4-one.
| Compound Name | 6-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-3-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386094 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 6-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-3-yl-2,3-dihydrochromen-4-one |
| SMILES | CN1CCCN(c2ccc3c(c2)C(=O)CC(c2cccnc2)O3)CC1 |
| InChI | InChI=1S/C20H23N3O2/c1-22-8-3-9-23(11-10-22)16-5-6-19-17(12-16)18(24)13-20(25-19)15-4-2-7-21-14-15/h2,4-7,12,14,20H,3,8-11,13H2,1H3 |
| InChIKey | FNTMKBHFFWGJJB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|