C20H21ClN2O3 — CID 141386085
2-(3-chloro-4-methoxyphenyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one (PubChem CID 141386085) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386085 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3cc(N4CCNCC4)ccc3O2)cc1Cl |
| InChI | InChI=1S/C20H21ClN2O3/c1-25-19-4-2-13(10-16(19)21)20-12-17(24)15-11-14(3-5-18(15)26-20)23-8-6-22-7-9-23/h2-5,10-11,20,22H,6-9,12H2,1H3 |
| InChIKey | FSAKSHSOTUXGET-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|