C21H23ClN2O3 — CID 141386048
2-(3-chloro-4-methoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one (PubChem CID 141386048) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141386048 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-6-[(3S)-3-methylpiperazin-1-yl]-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3cc(N4CCN[C@@H](C)C4)ccc3O2)cc1Cl |
| InChI | InChI=1S/C21H23ClN2O3/c1-13-12-24(8-7-23-13)15-4-6-19-16(10-15)18(25)11-21(27-19)14-3-5-20(26-2)17(22)9-14/h3-6,9-10,13,21,23H,7-8,11-12H2,1-2H3/t13-,21?/m0/s1 |
| InChIKey | YQYBIMNFDZARKR-JRTLGTJJSA-N |
| XLogP | 3.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|