About 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one
2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one (PubChem CID 141386037) has the molecular formula C17H19N3O2S
and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
| PubChem CID | 141386037 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one |
| SMILES | Cc1csc(C2CC(=O)c3cc(N4CCNCC4)ccc3O2)n1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-10-23-17(19-11)16-9-14(21)13-8-12(2-3-15(13)22-16)20-6-4-18-5-7-20/h2-3,8,10,16,18H,4-7,9H2,1H3 |
| InChIKey | KFPOHLFRZAETPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one (CID 141386037) is 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one is Cc1csc(C2CC(=O)c3cc(N4CCNCC4)ccc3O2)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one?
The InChIKey is KFPOHLFRZAETPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2S/c1-11-10-23-17(19-11)16-9-14(21)13-8-12(2-3-15(13)22-16)20-6-4-18-5-7-20/h2-3,8,10,16,18H,4-7,9H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one?
2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one has a molecular weight of 329.43 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)-6-piperazin-1-yl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 141386037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).