C10H19N3S — CID 143994298
ethane;4-methyl-2-piperazin-1-yl-1,3-thiazole (PubChem CID 143994298) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is ethane;4-methyl-2-piperazin-1-yl-1,3-thiazole.
| Compound Name | ethane;4-methyl-2-piperazin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 143994298 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | ethane;4-methyl-2-piperazin-1-yl-1,3-thiazole |
| SMILES | CC.Cc1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C8H13N3S.C2H6/c1-7-6-12-8(10-7)11-4-2-9-3-5-11;1-2/h6,9H,2-5H2,1H3;1-2H3 |
| InChIKey | RSJGEUJVVYMYMP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |