C9H15N3OS — CID 130542438
1-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-6-ol (PubChem CID 130542438) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-6-ol.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 130542438 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-6-ol |
| SMILES | Cc1csc(N2CCNCC(O)C2)n1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-6-14-9(11-7)12-3-2-10-4-8(13)5-12/h6,8,10,13H,2-5H2,1H3 |
| InChIKey | DDXXOUKRWGNFAL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |