C10H17N3S — CID 82673560
2-(3-ethylpiperazin-1-yl)-4-methyl-1,3-thiazole (PubChem CID 82673560) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-(3-ethylpiperazin-1-yl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(3-ethylpiperazin-1-yl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 82673560 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(3-ethylpiperazin-1-yl)-4-methyl-1,3-thiazole |
| SMILES | CCC1CN(c2nc(C)cs2)CCN1 |
| InChI | InChI=1S/C10H17N3S/c1-3-9-6-13(5-4-11-9)10-12-8(2)7-14-10/h7,9,11H,3-6H2,1-2H3 |
| InChIKey | LKPFXHQCTHSNMD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |