C8H9NO2S — CID 103439880
5-(4-methyl-1,3-thiazol-2-yl)oxolan-2-one (PubChem CID 103439880) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-(4-methyl-1,3-thiazol-2-yl)oxolan-2-one.
| Compound Name | 5-(4-methyl-1,3-thiazol-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 103439880 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 5-(4-methyl-1,3-thiazol-2-yl)oxolan-2-one |
| SMILES | Cc1csc(C2CCC(=O)O2)n1 |
| InChI | InChI=1S/C8H9NO2S/c1-5-4-12-8(9-5)6-2-3-7(10)11-6/h4,6H,2-3H2,1H3 |
| InChIKey | HDDQDWJURUHHMQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |