C10H16N2OS — CID 142081571
ethane;4-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 142081571) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is ethane;4-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | ethane;4-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 142081571 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | ethane;4-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | CC.Cc1csc(C2CNC(=O)C2)n1 |
| InChI | InChI=1S/C8H10N2OS.C2H6/c1-5-4-12-8(10-5)6-2-7(11)9-3-6;1-2/h4,6H,2-3H2,1H3,(H,9,11);1-2H3 |
| InChIKey | QHLHXADUYSLEFV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |