C9H11NS — CID 167193666
4-methyl-2-(3-methylidenecyclobutyl)-1,3-thiazole (PubChem CID 167193666) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-methyl-2-(3-methylidenecyclobutyl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(3-methylidenecyclobutyl)-1,3-thiazole |
|---|---|
| PubChem CID | 167193666 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-methyl-2-(3-methylidenecyclobutyl)-1,3-thiazole |
| SMILES | C=C1CC(c2nc(C)cs2)C1 |
| InChI | InChI=1S/C9H11NS/c1-6-3-8(4-6)9-10-7(2)5-11-9/h5,8H,1,3-4H2,2H3 |
| InChIKey | UDRDNJTVSHUADH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|