C12H18BrNS — CID 165498217
2-(5-bromo-2-ethylcyclohexyl)-4-methyl-1,3-thiazole (PubChem CID 165498217) has the molecular formula C12H18BrNS and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-(5-bromo-2-ethylcyclohexyl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(5-bromo-2-ethylcyclohexyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 165498217 |
| Molecular Formula | C12H18BrNS |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(5-bromo-2-ethylcyclohexyl)-4-methyl-1,3-thiazole |
| SMILES | CCC1CCC(Br)CC1c1nc(C)cs1 |
| InChI | InChI=1S/C12H18BrNS/c1-3-9-4-5-10(13)6-11(9)12-14-8(2)7-15-12/h7,9-11H,3-6H2,1-2H3 |
| InChIKey | WFPBSZIUJHCBPX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|