About N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine
N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine (PubChem CID 104771669) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine |
| PubChem CID | 104771669 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine |
| SMILES | Cc1csc(C2CC2CNC2CC2)n1 |
| InChI | InChI=1S/C11H16N2S/c1-7-6-14-11(13-7)10-4-8(10)5-12-9-2-3-9/h6,8-10,12H,2-5H2,1H3 |
| InChIKey | XQBYWOURNISACZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine?
The IUPAC name of N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine (CID 104771669) is N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine is Cc1csc(C2CC2CNC2CC2)n1.
What is the InChIKey of N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine?
The InChIKey is XQBYWOURNISACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c1-7-6-14-11(13-7)10-4-8(10)5-12-9-2-3-9/h6,8-10,12H,2-5H2,1H3.
What are the key properties of N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine?
N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine has a molecular weight of 208.33 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(4-methyl-1,3-thiazol-2-yl)cyclopropyl]methyl]cyclopropanamine is sourced from PubChem (CID 104771669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).