C7H9NO2S — CID 19974066
2-(1,3-dioxolan-2-yl)-4-methyl-1,3-thiazole (PubChem CID 19974066) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(1,3-dioxolan-2-yl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 19974066 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(C2OCCO2)n1 |
| InChI | InChI=1S/C7H9NO2S/c1-5-4-11-6(8-5)7-9-2-3-10-7/h4,7H,2-3H2,1H3 |
| InChIKey | BIDIFONCVHDMGM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |