About 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one
2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one (PubChem CID 104772323) has the molecular formula C7H7N3O2S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one |
| PubChem CID | 104772323 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one |
| SMILES | Cc1csc(C2OC(N)=NC2=O)n1 |
| InChI | InChI=1S/C7H7N3O2S/c1-3-2-13-6(9-3)4-5(11)10-7(8)12-4/h2,4H,1H3,(H2,8,10,11) |
| InChIKey | XQRHSBNRDSTTEX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one?
The IUPAC name of 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one (CID 104772323) is 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one.
What is the SMILES notation for 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one?
The canonical SMILES for 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one is Cc1csc(C2OC(N)=NC2=O)n1.
What is the InChIKey of 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one?
The InChIKey is XQRHSBNRDSTTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S/c1-3-2-13-6(9-3)4-5(11)10-7(8)12-4/h2,4H,1H3,(H2,8,10,11).
What are the key properties of 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one?
2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one has a molecular weight of 197.22 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(4-methyl-1,3-thiazol-2-yl)-1,3-oxazol-4-one is sourced from PubChem (CID 104772323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).