C10H12N2O2S — CID 104772126
3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-2,6-dione (PubChem CID 104772126) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 104772126 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-2,6-dione |
| SMILES | Cc1csc(C2CC(=O)NC(=O)C2C)n1 |
| InChI | InChI=1S/C10H12N2O2S/c1-5-4-15-10(11-5)7-3-8(13)12-9(14)6(7)2/h4,6-7H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | WGSUNEUILPWHEJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|