C9H12N2OS — CID 131059716
3-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-2-one (PubChem CID 131059716) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-2-one.
| Compound Name | 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 131059716 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-2-one |
| SMILES | Cc1nc(C2CNC(=O)C2C)cs1 |
| InChI | InChI=1S/C9H12N2OS/c1-5-7(3-10-9(5)12)8-4-13-6(2)11-8/h4-5,7H,3H2,1-2H3,(H,10,12) |
| InChIKey | KVXFEWAFIMMRFN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |