C8H11N3OS — CID 83484969
3-amino-4-(2-methyl-1,3-thiazol-5-yl)pyrrolidin-2-one (PubChem CID 83484969) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-amino-4-(2-methyl-1,3-thiazol-5-yl)pyrrolidin-2-one.
| Compound Name | 3-amino-4-(2-methyl-1,3-thiazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 83484969 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-amino-4-(2-methyl-1,3-thiazol-5-yl)pyrrolidin-2-one |
| SMILES | Cc1ncc(C2CNC(=O)C2N)s1 |
| InChI | InChI=1S/C8H11N3OS/c1-4-10-3-6(13-4)5-2-11-8(12)7(5)9/h3,5,7H,2,9H2,1H3,(H,11,12) |
| InChIKey | BMPMOJDEXBJRQO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |