C12H19N3OS — CID 82381757
10-(2-methyl-1,3-thiazol-5-yl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-d][1,4]diazepine (PubChem CID 82381757) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 10-(2-methyl-1,3-thiazol-5-yl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-d][1,4]diazepine.
| Compound Name | 10-(2-methyl-1,3-thiazol-5-yl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 82381757 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 10-(2-methyl-1,3-thiazol-5-yl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-d][1,4]diazepine |
| SMILES | Cc1ncc(C2CNCCN3CCOCC23)s1 |
| InChI | InChI=1S/C12H19N3OS/c1-9-14-7-12(17-9)10-6-13-2-3-15-4-5-16-8-11(10)15/h7,10-11,13H,2-6,8H2,1H3 |
| InChIKey | VMONLWRHSPHAFB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |