C9H18N2O3 — CID 175662484
(3R,4S,5R)-5-piperazin-1-yloxane-3,4-diol (PubChem CID 175662484) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3R,4S,5R)-5-piperazin-1-yloxane-3,4-diol.
| Compound Name | (3R,4S,5R)-5-piperazin-1-yloxane-3,4-diol |
|---|---|
| PubChem CID | 175662484 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (3R,4S,5R)-5-piperazin-1-yloxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)COC[C@H]1N1CCNCC1 |
| InChI | InChI=1S/C9H18N2O3/c12-8-6-14-5-7(9(8)13)11-3-1-10-2-4-11/h7-10,12-13H,1-6H2/t7-,8-,9+/m1/s1 |
| InChIKey | BCYARMSGAIYHQG-HLTSFMKQSA-N |
| XLogP | -1.99 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |