C10H13N3O2S — CID 63090398
3-methyl-4-(2-methyl-1,3-thiazole-4-carbonyl)piperazin-2-one (PubChem CID 63090398) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-1,3-thiazole-4-carbonyl)piperazin-2-one.
| Compound Name | 3-methyl-4-(2-methyl-1,3-thiazole-4-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 63090398 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-methyl-4-(2-methyl-1,3-thiazole-4-carbonyl)piperazin-2-one |
| SMILES | Cc1nc(C(=O)N2CCNC(=O)C2C)cs1 |
| InChI | InChI=1S/C10H13N3O2S/c1-6-9(14)11-3-4-13(6)10(15)8-5-16-7(2)12-8/h5-6H,3-4H2,1-2H3,(H,11,14) |
| InChIKey | OKXXBNUUNVZAQW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |