C10H12N2O2S — CID 25283897
(3S)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one (PubChem CID 25283897) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is (3S)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one.
| Compound Name | (3S)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 25283897 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (3S)-3-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
| SMILES | C[C@H]1C(=O)NCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C10H12N2O2S/c1-7-9(13)11-4-5-12(7)10(14)8-3-2-6-15-8/h2-3,6-7H,4-5H2,1H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | BFJSNMWBQIZNMI-ZETCQYMHSA-N |
| XLogP | 0.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |