C25H32N4O5S — CID 157386126
formic acid;1-[3-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-6-(4-methylpiperazin-1-yl)indole (PubChem CID 157386126) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is formic acid;1-[3-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-6-(4-methylpiperazin-1-yl)indole.
| Compound Name | formic acid;1-[3-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-6-(4-methylpiperazin-1-yl)indole |
|---|---|
| PubChem CID | 157386126 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | formic acid;1-[3-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-6-(4-methylpiperazin-1-yl)indole |
| SMILES | COC1CCN(c2cccc(S(=O)(=O)n3ccc4ccc(N5CCN(C)CC5)cc43)c2)C1.O=CO |
| InChI | InChI=1S/C24H30N4O3S.CH2O2/c1-25-12-14-26(15-13-25)21-7-6-19-8-11-28(24(19)17-21)32(29,30)23-5-3-4-20(16-23)27-10-9-22(18-27)31-2;2-1-3/h3-8,11,16-17,22H,9-10,12-15,18H2,1-2H3;1H,(H,2,3) |
| InChIKey | BLLISVXBNFKFIO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|