C11H14LiNO3S — CID 68542056
lithium 3-(3-methoxypyrrolidin-1-yl)benzenesulfinate (PubChem CID 68542056) has the molecular formula C11H14LiNO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is lithium 3-(3-methoxypyrrolidin-1-yl)benzenesulfinate.
| Compound Name | lithium 3-(3-methoxypyrrolidin-1-yl)benzenesulfinate |
|---|---|
| PubChem CID | 68542056 |
| Molecular Formula | C11H14LiNO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | lithium 3-(3-methoxypyrrolidin-1-yl)benzenesulfinate |
| SMILES | COC1CCN(c2cccc(S(=O)[O-])c2)C1.[Li+] |
| InChI | InChI=1S/C11H15NO3S.Li/c1-15-10-5-6-12(8-10)9-3-2-4-11(7-9)16(13)14;/h2-4,7,10H,5-6,8H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | ABYJBTNDLPTCIZ-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|