C18H21FN2O3S — CID 90595560
1-(3-fluorophenyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]methanesulfonamide (PubChem CID 90595560) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90595560 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[4-(3-methoxypyrrolidin-1-yl)phenyl]methanesulfonamide |
| SMILES | COC1CCN(c2ccc(NS(=O)(=O)Cc3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C18H21FN2O3S/c1-24-18-9-10-21(12-18)17-7-5-16(6-8-17)20-25(22,23)13-14-3-2-4-15(19)11-14/h2-8,11,18,20H,9-10,12-13H2,1H3 |
| InChIKey | CXVYTQNMGVNZSU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|