C11H14FNO2S — CID 56513002
N-(cyclopropylmethyl)-1-(3-fluorophenyl)methanesulfonamide (PubChem CID 56513002) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(3-fluorophenyl)methanesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-1-(3-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 56513002 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(3-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)NCC1CC1 |
| InChI | InChI=1S/C11H14FNO2S/c12-11-3-1-2-10(6-11)8-16(14,15)13-7-9-4-5-9/h1-3,6,9,13H,4-5,7-8H2 |
| InChIKey | CPSVUWHGWSJHKY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |