C17H21FN4O2S — CID 121108298
1-(3-fluorophenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]methanesulfonamide (PubChem CID 121108298) has the molecular formula C17H21FN4O2S and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 121108298 |
| Molecular Formula | C17H21FN4O2S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)NCC1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C17H21FN4O2S/c18-16-3-1-2-15(10-16)13-25(23,24)21-11-14-4-8-22(9-5-14)17-12-19-6-7-20-17/h1-3,6-7,10,12,14,21H,4-5,8-9,11,13H2 |
| InChIKey | DMHOZTYHKLWMGT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |