C17H19F3N4O3S — CID 71786437
N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 71786437) has the molecular formula C17H19F3N4O3S and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 71786437 |
| Molecular Formula | C17H19F3N4O3S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCN(c2cnccn2)CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O3S/c18-17(19,20)27-14-1-3-15(4-2-14)28(25,26)23-11-13-5-9-24(10-6-13)16-12-21-7-8-22-16/h1-4,7-8,12-13,23H,5-6,9-11H2 |
| InChIKey | QXCKPOPOGCTHTD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |