C15H16FN3O2S — CID 122264174
N-[(6-cyclopropylpyrimidin-4-yl)methyl]-1-(3-fluorophenyl)methanesulfonamide (PubChem CID 122264174) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(6-cyclopropylpyrimidin-4-yl)methyl]-1-(3-fluorophenyl)methanesulfonamide.
| Compound Name | N-[(6-cyclopropylpyrimidin-4-yl)methyl]-1-(3-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 122264174 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[(6-cyclopropylpyrimidin-4-yl)methyl]-1-(3-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)NCc1cc(C2CC2)ncn1 |
| InChI | InChI=1S/C15H16FN3O2S/c16-13-3-1-2-11(6-13)9-22(20,21)19-8-14-7-15(12-4-5-12)18-10-17-14/h1-3,6-7,10,12,19H,4-5,8-9H2 |
| InChIKey | JRVPUSSTOIAKAM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |