C11H13FO2S — CID 167784424
1-(cyclopropylmethylsulfonylmethyl)-3-fluorobenzene (PubChem CID 167784424) has the molecular formula C11H13FO2S and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(cyclopropylmethylsulfonylmethyl)-3-fluorobenzene.
| Compound Name | 1-(cyclopropylmethylsulfonylmethyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 167784424 |
| Molecular Formula | C11H13FO2S |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(cyclopropylmethylsulfonylmethyl)-3-fluorobenzene |
| SMILES | O=S(=O)(Cc1cccc(F)c1)CC1CC1 |
| InChI | InChI=1S/C11H13FO2S/c12-11-3-1-2-10(6-11)8-15(13,14)7-9-4-5-9/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | KLOCIAJKRHABHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |