C23H41N2O2S- — CID 178004799
ethane;methane;3-[4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfinate (PubChem CID 178004799) has the molecular formula C23H41N2O2S- and a molecular weight of 409.66 g/mol. Its IUPAC name is ethane;methane;3-[4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfinate.
| Compound Name | ethane;methane;3-[4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 178004799 |
| Molecular Formula | C23H41N2O2S- |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | ethane;methane;3-[4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfinate |
| SMILES | C.CC.CC(C)C1CCN(CC2CCN(c3cccc(S(=O)[O-])c3)CC2)CC1 |
| InChI | InChI=1S/C20H32N2O2S.C2H6.CH4/c1-16(2)18-8-10-21(11-9-18)15-17-6-12-22(13-7-17)19-4-3-5-20(14-19)25(23)24;1-2;/h3-5,14,16-18H,6-13,15H2,1-2H3,(H,23,24);1-2H3;1H4/p-1 |
| InChIKey | TVXFPVJLCHHGHS-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|