C17H25N3O2S — CID 178004301
3-[4-(3,6-diazabicyclo[3.1.1]heptan-6-ylmethyl)piperidin-1-yl]benzenesulfinic acid (PubChem CID 178004301) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-[4-(3,6-diazabicyclo[3.1.1]heptan-6-ylmethyl)piperidin-1-yl]benzenesulfinic acid.
| Compound Name | 3-[4-(3,6-diazabicyclo[3.1.1]heptan-6-ylmethyl)piperidin-1-yl]benzenesulfinic acid |
|---|---|
| PubChem CID | 178004301 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-[4-(3,6-diazabicyclo[3.1.1]heptan-6-ylmethyl)piperidin-1-yl]benzenesulfinic acid |
| SMILES | O=S(O)c1cccc(N2CCC(CN3C4CNCC3C4)CC2)c1 |
| InChI | InChI=1S/C17H25N3O2S/c21-23(22)17-3-1-2-14(9-17)19-6-4-13(5-7-19)12-20-15-8-16(20)11-18-10-15/h1-3,9,13,15-16,18H,4-8,10-12H2,(H,21,22) |
| InChIKey | CYKQTFXAPMUXOG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|