C21H37N3O2S — CID 170639106
ethane;1-[[1-(3-propan-2-ylsulfonylphenyl)piperidin-4-yl]methyl]piperazine (PubChem CID 170639106) has the molecular formula C21H37N3O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is ethane;1-[[1-(3-propan-2-ylsulfonylphenyl)piperidin-4-yl]methyl]piperazine.
| Compound Name | ethane;1-[[1-(3-propan-2-ylsulfonylphenyl)piperidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 170639106 |
| Molecular Formula | C21H37N3O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | ethane;1-[[1-(3-propan-2-ylsulfonylphenyl)piperidin-4-yl]methyl]piperazine |
| SMILES | CC.CC(C)S(=O)(=O)c1cccc(N2CCC(CN3CCNCC3)CC2)c1 |
| InChI | InChI=1S/C19H31N3O2S.C2H6/c1-16(2)25(23,24)19-5-3-4-18(14-19)22-10-6-17(7-11-22)15-21-12-8-20-9-13-21;1-2/h3-5,14,16-17,20H,6-13,15H2,1-2H3;1-2H3 |
| InChIKey | YESSZVPGHZMWFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |