C20H33N3O3 — CID 177052019
ethane;2-(hydroxymethyl)-4-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 177052019) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-4-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | ethane;2-(hydroxymethyl)-4-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 177052019 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | ethane;2-(hydroxymethyl)-4-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | CC.O=C(O)c1ccc(N2CCC(CN3CCNCC3)CC2)cc1CO |
| InChI | InChI=1S/C18H27N3O3.C2H6/c22-13-15-11-16(1-2-17(15)18(23)24)21-7-3-14(4-8-21)12-20-9-5-19-6-10-20;1-2/h1-2,11,14,19,22H,3-10,12-13H2,(H,23,24);1-2H3 |
| InChIKey | UURYUYFZLAZZOY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |