C24H30N4O5S — CID 68740770
formic acid;1-[2-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-4-piperazin-1-ylindole (PubChem CID 68740770) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is formic acid;1-[2-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-4-piperazin-1-ylindole.
| Compound Name | formic acid;1-[2-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-4-piperazin-1-ylindole |
|---|---|
| PubChem CID | 68740770 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | formic acid;1-[2-(3-methoxypyrrolidin-1-yl)phenyl]sulfonyl-4-piperazin-1-ylindole |
| SMILES | COC1CCN(c2ccccc2S(=O)(=O)n2ccc3c(N4CCNCC4)cccc32)C1.O=CO |
| InChI | InChI=1S/C23H28N4O3S.CH2O2/c1-30-18-9-13-26(17-18)22-5-2-3-8-23(22)31(28,29)27-14-10-19-20(6-4-7-21(19)27)25-15-11-24-12-16-25;2-1-3/h2-8,10,14,18,24H,9,11-13,15-17H2,1H3;1H,(H,2,3) |
| InChIKey | BWTOLLQGOJSRMR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|