C22H20FN3O2S — CID 141441903
2-fluoro-N,3-dimethyl-N-[(1-pyridin-3-ylsulfonylindol-3-yl)methyl]aniline (PubChem CID 141441903) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-fluoro-N,3-dimethyl-N-[(1-pyridin-3-ylsulfonylindol-3-yl)methyl]aniline.
| Compound Name | 2-fluoro-N,3-dimethyl-N-[(1-pyridin-3-ylsulfonylindol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 141441903 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-fluoro-N,3-dimethyl-N-[(1-pyridin-3-ylsulfonylindol-3-yl)methyl]aniline |
| SMILES | Cc1cccc(N(C)Cc2cn(S(=O)(=O)c3cccnc3)c3ccccc23)c1F |
| InChI | InChI=1S/C22H20FN3O2S/c1-16-7-5-11-21(22(16)23)25(2)14-17-15-26(20-10-4-3-9-19(17)20)29(27,28)18-8-6-12-24-13-18/h3-13,15H,14H2,1-2H3 |
| InChIKey | JYLKMKXTIQALGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |