C19H12FN3O4S — CID 134346754
6-(6-fluoro-3-pyridinyl)-1-pyridin-3-ylsulfonylindole-3-carboxylic acid (PubChem CID 134346754) has the molecular formula C19H12FN3O4S and a molecular weight of 397.39 g/mol. Its IUPAC name is 6-(6-fluoro-3-pyridinyl)-1-pyridin-3-ylsulfonylindole-3-carboxylic acid.
| Compound Name | 6-(6-fluoro-3-pyridinyl)-1-pyridin-3-ylsulfonylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 134346754 |
| Molecular Formula | C19H12FN3O4S |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 6-(6-fluoro-3-pyridinyl)-1-pyridin-3-ylsulfonylindole-3-carboxylic acid |
| SMILES | O=C(O)c1cn(S(=O)(=O)c2cccnc2)c2cc(-c3ccc(F)nc3)ccc12 |
| InChI | InChI=1S/C19H12FN3O4S/c20-18-6-4-13(9-22-18)12-3-5-15-16(19(24)25)11-23(17(15)8-12)28(26,27)14-2-1-7-21-10-14/h1-11H,(H,24,25) |
| InChIKey | VKXQQWXJUAEZIJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|