C17H14N2O6S — CID 58837923
3-(5-pyridin-3-ylsulfonyl-[1,3]dioxolo[4,5-f]indol-7-yl)propanoic acid (PubChem CID 58837923) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 3-(5-pyridin-3-ylsulfonyl-[1,3]dioxolo[4,5-f]indol-7-yl)propanoic acid.
| Compound Name | 3-(5-pyridin-3-ylsulfonyl-[1,3]dioxolo[4,5-f]indol-7-yl)propanoic acid |
|---|---|
| PubChem CID | 58837923 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-(5-pyridin-3-ylsulfonyl-[1,3]dioxolo[4,5-f]indol-7-yl)propanoic acid |
| SMILES | O=C(O)CCc1cn(S(=O)(=O)c2cccnc2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C17H14N2O6S/c20-17(21)4-3-11-9-19(26(22,23)12-2-1-5-18-8-12)14-7-16-15(6-13(11)14)24-10-25-16/h1-2,5-9H,3-4,10H2,(H,20,21) |
| InChIKey | DHMXKTQDEXJKCX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |