C25H30NO+ — CID 2393132
(3Z,5Z)-1-ethyl-3,5-bis[(4-ethylphenyl)methylidene]piperidin-1-ium-4-one (PubChem CID 2393132) has the molecular formula C25H30NO+ and a molecular weight of 360.52 g/mol. Its IUPAC name is (3Z,5Z)-1-ethyl-3,5-bis[(4-ethylphenyl)methylidene]piperidin-1-ium-4-one.
| Compound Name | (3Z,5Z)-1-ethyl-3,5-bis[(4-ethylphenyl)methylidene]piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 2393132 |
| Molecular Formula | C25H30NO+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (3Z,5Z)-1-ethyl-3,5-bis[(4-ethylphenyl)methylidene]piperidin-1-ium-4-one |
| SMILES | CCc1ccc(/C=C2/C[NH+](CC)C/C(=C/c3ccc(CC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H29NO/c1-4-19-7-11-21(12-8-19)15-23-17-26(6-3)18-24(25(23)27)16-22-13-9-20(5-2)10-14-22/h7-16H,4-6,17-18H2,1-3H3/p+1/b23-15-,24-16- |
| InChIKey | JIDKXPOPUHUAEU-MPKYGIEOSA-O |
| XLogP | 3.77 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|