C25H30NO3+ — CID 2382708
(3E,5E)-3,5-bis[(4-ethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one (PubChem CID 2382708) has the molecular formula C25H30NO3+ and a molecular weight of 392.52 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-ethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-ethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 2382708 |
| Molecular Formula | C25H30NO3+ |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-ethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one |
| SMILES | CCOc1ccc(/C=C2\C[NH+](CC)C/C(=C\c3ccc(OCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H29NO3/c1-4-26-17-21(15-19-7-11-23(12-8-19)28-5-2)25(27)22(18-26)16-20-9-13-24(14-10-20)29-6-3/h7-16H,4-6,17-18H2,1-3H3/p+1/b21-15+,22-16+ |
| InChIKey | HPADWTBMLJTJPT-YHARCJFQSA-O |
| XLogP | 3.44 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|