C15H10N2O2 — CID 14075046
spiro[indeno[1,2-b]pyridine-5,3'-pyrrolidine]-2',5'-dione (PubChem CID 14075046) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is spiro[indeno[1,2-b]pyridine-5,3'-pyrrolidine]-2',5'-dione.
| Compound Name | spiro[indeno[1,2-b]pyridine-5,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 14075046 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | spiro[indeno[1,2-b]pyridine-5,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1CC2(C(=O)N1)c1ccccc1-c1ncccc12 |
| InChI | InChI=1S/C15H10N2O2/c18-12-8-15(14(19)17-12)10-5-2-1-4-9(10)13-11(15)6-3-7-16-13/h1-7H,8H2,(H,17,18,19) |
| InChIKey | KNUMHEFMASCUDP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|