C19H15NO5 — CID 66957986
methyl 3-(9H-fluoren-9-yl)-1-hydroxy-2,5-dioxopyrrolidine-3-carboxylate (PubChem CID 66957986) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is methyl 3-(9H-fluoren-9-yl)-1-hydroxy-2,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | methyl 3-(9H-fluoren-9-yl)-1-hydroxy-2,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 66957986 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methyl 3-(9H-fluoren-9-yl)-1-hydroxy-2,5-dioxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(C2c3ccccc3-c3ccccc32)CC(=O)N(O)C1=O |
| InChI | InChI=1S/C19H15NO5/c1-25-18(23)19(10-15(21)20(24)17(19)22)16-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16/h2-9,16,24H,10H2,1H3 |
| InChIKey | WTIOHVISQHMAGY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|