C18H14Cl2O2 — CID 7864040
9H-fluoren-9-yl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864040) has the molecular formula C18H14Cl2O2 and a molecular weight of 333.21 g/mol. Its IUPAC name is 9H-fluoren-9-yl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | 9H-fluoren-9-yl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864040 |
| Molecular Formula | C18H14Cl2O2 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 9H-fluoren-9-yl (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)OC2c3ccccc3-c3ccccc32)CC1(Cl)Cl |
| InChI | InChI=1S/C18H14Cl2O2/c1-17(10-18(17,19)20)16(21)22-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9,15H,10H2,1H3/t17-/m1/s1 |
| InChIKey | SALDGORCXMURFM-QGZVFWFLSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|