About 9H-fluoren-9-yl 4-amino-3-methylbenzoate
9H-fluoren-9-yl 4-amino-3-methylbenzoate (PubChem CID 91682868) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is 9H-fluoren-9-yl 4-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl 4-amino-3-methylbenzoate |
| PubChem CID | 91682868 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 9H-fluoren-9-yl 4-amino-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OC2c3ccccc3-c3ccccc32)ccc1N |
| InChI | InChI=1S/C21H17NO2/c1-13-12-14(10-11-19(13)22)21(23)24-20-17-8-4-2-6-15(17)16-7-3-5-9-18(16)20/h2-12,20H,22H2,1H3 |
| InChIKey | VMHLQLIDCOQTSR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-yl 4-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl 4-amino-3-methylbenzoate?
The IUPAC name of 9H-fluoren-9-yl 4-amino-3-methylbenzoate (CID 91682868) is 9H-fluoren-9-yl 4-amino-3-methylbenzoate.
What is the SMILES notation for 9H-fluoren-9-yl 4-amino-3-methylbenzoate?
The canonical SMILES for 9H-fluoren-9-yl 4-amino-3-methylbenzoate is Cc1cc(C(=O)OC2c3ccccc3-c3ccccc32)ccc1N.
What is the InChIKey of 9H-fluoren-9-yl 4-amino-3-methylbenzoate?
The InChIKey is VMHLQLIDCOQTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2/c1-13-12-14(10-11-19(13)22)21(23)24-20-17-8-4-2-6-15(17)16-7-3-5-9-18(16)20/h2-12,20H,22H2,1H3.
What are the key properties of 9H-fluoren-9-yl 4-amino-3-methylbenzoate?
9H-fluoren-9-yl 4-amino-3-methylbenzoate has a molecular weight of 315.37 g/mol, XLogP of 4.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl 4-amino-3-methylbenzoate is sourced from PubChem (CID 91682868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).