About 4-methylpentan-2-yl 4-amino-3-methylbenzoate
4-methylpentan-2-yl 4-amino-3-methylbenzoate (PubChem CID 61278819) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-methylpentan-2-yl 4-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl 4-amino-3-methylbenzoate |
| PubChem CID | 61278819 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-methylpentan-2-yl 4-amino-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OC(C)CC(C)C)ccc1N |
| InChI | InChI=1S/C14H21NO2/c1-9(2)7-11(4)17-14(16)12-5-6-13(15)10(3)8-12/h5-6,8-9,11H,7,15H2,1-4H3 |
| InChIKey | PISDLAUIXDLUMA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-yl 4-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl 4-amino-3-methylbenzoate?
The IUPAC name of 4-methylpentan-2-yl 4-amino-3-methylbenzoate (CID 61278819) is 4-methylpentan-2-yl 4-amino-3-methylbenzoate.
What is the SMILES notation for 4-methylpentan-2-yl 4-amino-3-methylbenzoate?
The canonical SMILES for 4-methylpentan-2-yl 4-amino-3-methylbenzoate is Cc1cc(C(=O)OC(C)CC(C)C)ccc1N.
What is the InChIKey of 4-methylpentan-2-yl 4-amino-3-methylbenzoate?
The InChIKey is PISDLAUIXDLUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-9(2)7-11(4)17-14(16)12-5-6-13(15)10(3)8-12/h5-6,8-9,11H,7,15H2,1-4H3.
What are the key properties of 4-methylpentan-2-yl 4-amino-3-methylbenzoate?
4-methylpentan-2-yl 4-amino-3-methylbenzoate has a molecular weight of 235.33 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 4-amino-3-methylbenzoate is sourced from PubChem (CID 61278819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).