9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate

C25H24O4 — CID 7908802

IUPAC9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate
SMILESCCCOc1ccc(C(=O)OC2c3ccccc3-c3ccccc32)cc1OCC
InChIInChI=1S/C25H24O4/c1-3-15-28-22-14-13-17(16-23(22)27-4-2)25(26)29-24-20-11-7-5-9-18(20)19-10-6-8-12-21(19)24/h5-14,16,24H,3-4,15H2,1-2H3
InChIKeyVYYVMHVANBQMBY-UHFFFAOYSA-N
MW388.46 g/mol
LogP5.80
Rot. Bonds7

About 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate

9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate (PubChem CID 7908802) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate.

Molecular Properties

Compound Name9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate
PubChem CID7908802
Molecular FormulaC25H24O4
Molecular Weight388.46 g/mol
Exact Mass388.17
IUPAC Name9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate
SMILESCCCOc1ccc(C(=O)OC2c3ccccc3-c3ccccc32)cc1OCC
InChIInChI=1S/C25H24O4/c1-3-15-28-22-14-13-17(16-23(22)27-4-2)25(26)29-24-20-11-7-5-9-18(20)19-10-6-8-12-21(19)24/h5-14,16,24H,3-4,15H2,1-2H3
InChIKeyVYYVMHVANBQMBY-UHFFFAOYSA-N
XLogP5.80
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500388.46
LogP ≤ 55.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The IUPAC name of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate (CID 7908802) is 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate.
What is the SMILES notation for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The canonical SMILES for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate is CCCOc1ccc(C(=O)OC2c3ccccc3-c3ccccc32)cc1OCC.
What is the InChIKey of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The InChIKey is VYYVMHVANBQMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24O4/c1-3-15-28-22-14-13-17(16-23(22)27-4-2)25(26)29-24-20-11-7-5-9-18(20)19-10-6-8-12-21(19)24/h5-14,16,24H,3-4,15H2,1-2H3.
What are the key properties of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate has a molecular weight of 388.46 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate is sourced from PubChem (CID 7908802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).