About 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate
9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate (PubChem CID 7908802) has the molecular formula C25H24O4
and a molecular weight of 388.46 g/mol. Its IUPAC name is 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate |
| PubChem CID | 7908802 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OC2c3ccccc3-c3ccccc32)cc1OCC |
| InChI | InChI=1S/C25H24O4/c1-3-15-28-22-14-13-17(16-23(22)27-4-2)25(26)29-24-20-11-7-5-9-18(20)19-10-6-8-12-21(19)24/h5-14,16,24H,3-4,15H2,1-2H3 |
| InChIKey | VYYVMHVANBQMBY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The IUPAC name of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate (CID 7908802) is 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate.
What is the SMILES notation for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The canonical SMILES for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate is CCCOc1ccc(C(=O)OC2c3ccccc3-c3ccccc32)cc1OCC.
What is the InChIKey of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
The InChIKey is VYYVMHVANBQMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24O4/c1-3-15-28-22-14-13-17(16-23(22)27-4-2)25(26)29-24-20-11-7-5-9-18(20)19-10-6-8-12-21(19)24/h5-14,16,24H,3-4,15H2,1-2H3.
What are the key properties of 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate?
9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate has a molecular weight of 388.46 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl 3-ethoxy-4-propoxybenzoate is sourced from PubChem (CID 7908802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).