C23H25NO4 — CID 168751618
2-(9H-fluoren-9-yloxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid (PubChem CID 168751618) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yloxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid.
| Compound Name | 2-(9H-fluoren-9-yloxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 168751618 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(9H-fluoren-9-yloxycarbonylamino)-2-(1-methylcyclohexyl)acetic acid |
| SMILES | CC1(C(NC(=O)OC2c3ccccc3-c3ccccc32)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C23H25NO4/c1-23(13-7-2-8-14-23)20(21(25)26)24-22(27)28-19-17-11-5-3-9-15(17)16-10-4-6-12-18(16)19/h3-6,9-12,19-20H,2,7-8,13-14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | QUMRUNQFJGJBLH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |